C22H14F3N3O2 — CID 2005084
(1S,11R,12R,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile (PubChem CID 2005084) has the molecular formula C22H14F3N3O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is (1S,11R,12R,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile.
| Compound Name | (1S,11R,12R,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 2005084 |
| Molecular Formula | C22H14F3N3O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (1S,11R,12R,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonitrile |
| SMILES | N#C[C@H]1[C@@H]2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]2[C@H]2c3ccccc3C=CN21 |
| InChI | InChI=1S/C22H14F3N3O2/c23-22(24,25)13-5-3-6-14(10-13)28-20(29)17-16(11-26)27-9-8-12-4-1-2-7-15(12)19(27)18(17)21(28)30/h1-10,16-19H/t16-,17-,18-,19+/m0/s1 |
| InChIKey | AKTWYVVKDWVAPK-CADBVGFASA-N |
| XLogP | 3.74 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|