C22H16F3N3O3 — CID 40923118
(1R,11R,12S,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 40923118) has the molecular formula C22H16F3N3O3 and a molecular weight of 427.38 g/mol. Its IUPAC name is (1R,11R,12S,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1R,11R,12S,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 40923118 |
| Molecular Formula | C22H16F3N3O3 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (1R,11R,12S,16S)-13,15-dioxo-14-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | NC(=O)[C@H]1[C@H]2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C22H16F3N3O3/c23-22(24,25)12-5-3-6-13(10-12)28-20(30)15-16(21(28)31)18(19(26)29)27-9-8-11-4-1-2-7-14(11)17(15)27/h1-10,15-18H,(H2,26,29)/t15-,16-,17-,18+/m0/s1 |
| InChIKey | RESSSVYMVVHWDL-XLAORIBOSA-N |
| XLogP | 2.71 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|