C32H22F3N3O3 — CID 98380422
(1R,11S,12R,16S)-14-naphthalen-2-yl-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 98380422) has the molecular formula C32H22F3N3O3 and a molecular weight of 553.54 g/mol. Its IUPAC name is (1R,11S,12R,16S)-14-naphthalen-2-yl-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1R,11S,12R,16S)-14-naphthalen-2-yl-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 98380422 |
| Molecular Formula | C32H22F3N3O3 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (1R,11S,12R,16S)-14-naphthalen-2-yl-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)[C@@H]1[C@@H]2C(=O)N(c3ccc4ccccc4c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C32H22F3N3O3/c33-32(34,35)21-9-5-10-22(17-21)36-29(39)28-26-25(27-24-11-4-3-7-19(24)14-15-37(27)28)30(40)38(31(26)41)23-13-12-18-6-1-2-8-20(18)16-23/h1-17,25-28H,(H,36,39)/t25-,26+,27-,28-/m0/s1 |
| InChIKey | DRIHSNFSDAAMGQ-PUHABZHSSA-N |
| XLogP | 6.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|