C31H22ClN3O3 — CID 51669539
(1R,11S,12R,16S)-N-(4-chlorophenyl)-14-naphthalen-2-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 51669539) has the molecular formula C31H22ClN3O3 and a molecular weight of 519.99 g/mol. Its IUPAC name is (1R,11S,12R,16S)-N-(4-chlorophenyl)-14-naphthalen-2-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1R,11S,12R,16S)-N-(4-chlorophenyl)-14-naphthalen-2-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 51669539 |
| Molecular Formula | C31H22ClN3O3 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (1R,11S,12R,16S)-N-(4-chlorophenyl)-14-naphthalen-2-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H]1[C@@H]2C(=O)N(c3ccc4ccccc4c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C31H22ClN3O3/c32-21-10-12-22(13-11-21)33-29(36)28-26-25(27-24-8-4-3-6-19(24)15-16-34(27)28)30(37)35(31(26)38)23-14-9-18-5-1-2-7-20(18)17-23/h1-17,25-28H,(H,33,36)/t25-,26+,27-,28-/m0/s1 |
| InChIKey | LAYVABPTMMISSK-PUHABZHSSA-N |
| XLogP | 5.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|