C29H22ClN3O4 — CID 3847485
14-(4-acetylphenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 3847485) has the molecular formula C29H22ClN3O4 and a molecular weight of 511.97 g/mol. Its IUPAC name is 14-(4-acetylphenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | 14-(4-acetylphenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 3847485 |
| Molecular Formula | C29H22ClN3O4 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 14-(4-acetylphenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | CC(=O)c1ccc(N2C(=O)C3C(C2=O)C2c4ccccc4C=CN2C3C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H22ClN3O4/c1-16(34)17-6-12-21(13-7-17)33-28(36)23-24(29(33)37)26(27(35)31-20-10-8-19(30)9-11-20)32-15-14-18-4-2-3-5-22(18)25(23)32/h2-15,23-26H,1H3,(H,31,35) |
| InChIKey | HSLQSUSSRCHAPT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|