C28H23N3O4 — CID 41000207
(1R,11S,12R,16S)-N-(4-methoxyphenyl)-13,15-dioxo-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 41000207) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is (1R,11S,12R,16S)-N-(4-methoxyphenyl)-13,15-dioxo-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1R,11S,12R,16S)-N-(4-methoxyphenyl)-13,15-dioxo-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 41000207 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (1R,11S,12R,16S)-N-(4-methoxyphenyl)-13,15-dioxo-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C28H23N3O4/c1-35-20-13-11-18(12-14-20)29-26(32)25-23-22(24-21-10-6-5-7-17(21)15-16-30(24)25)27(33)31(28(23)34)19-8-3-2-4-9-19/h2-16,22-25H,1H3,(H,29,32)/t22-,23+,24-,25-/m0/s1 |
| InChIKey | LKZBLJXQHFYYFM-NDBXHCKUSA-N |
| XLogP | 3.85 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|