C29H25N3O4 — CID 124773579
(1R,11S,12R,16R)-14-benzyl-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 124773579) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is (1R,11S,12R,16R)-14-benzyl-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1R,11S,12R,16R)-14-benzyl-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 124773579 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (1R,11S,12R,16R)-14-benzyl-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@@H]3C(=O)N(Cc4ccccc4)C(=O)[C@H]3[C@@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C29H25N3O4/c1-36-21-13-11-20(12-14-21)30-27(33)26-24-23(25-22-10-6-5-9-19(22)15-16-31(25)26)28(34)32(29(24)35)17-18-7-3-2-4-8-18/h2-16,23-26H,17H2,1H3,(H,30,33)/t23-,24-,25+,26+/m1/s1 |
| InChIKey | JCIZSPTVSDDPDB-XPGKHFPBSA-N |
| XLogP | 3.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|