C28H21Cl2N3O4 — CID 98171572
(1R,11S,12R,16S)-14-(3,5-dichlorophenyl)-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 98171572) has the molecular formula C28H21Cl2N3O4 and a molecular weight of 534.40 g/mol. Its IUPAC name is (1R,11S,12R,16S)-14-(3,5-dichlorophenyl)-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1R,11S,12R,16S)-14-(3,5-dichlorophenyl)-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 98171572 |
| Molecular Formula | C28H21Cl2N3O4 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | (1R,11S,12R,16S)-14-(3,5-dichlorophenyl)-N-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@@H]3C(=O)N(c4cc(Cl)cc(Cl)c4)C(=O)[C@@H]3[C@@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C28H21Cl2N3O4/c1-37-20-8-6-18(7-9-20)31-26(34)25-23-22(24-21-5-3-2-4-15(21)10-11-32(24)25)27(35)33(28(23)36)19-13-16(29)12-17(30)14-19/h2-14,22-25H,1H3,(H,31,34)/t22-,23+,24-,25-/m0/s1 |
| InChIKey | CMQFWLSIKUZOSE-NDBXHCKUSA-N |
| XLogP | 5.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|