C27H19Cl2N3O3 — CID 3809752
14-(2-chlorophenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 3809752) has the molecular formula C27H19Cl2N3O3 and a molecular weight of 504.37 g/mol. Its IUPAC name is 14-(2-chlorophenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | 14-(2-chlorophenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 3809752 |
| Molecular Formula | C27H19Cl2N3O3 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | 14-(2-chlorophenyl)-N-(4-chlorophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1C2C(=O)N(c3ccccc3Cl)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H19Cl2N3O3/c28-16-9-11-17(12-10-16)30-25(33)24-22-21(23-18-6-2-1-5-15(18)13-14-31(23)24)26(34)32(27(22)35)20-8-4-3-7-19(20)29/h1-14,21-24H,(H,30,33) |
| InChIKey | APGPFMWEWCRIEW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|