C25H23ClN2O3 — CID 3744749
14-(2-chlorophenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3744749) has the molecular formula C25H23ClN2O3 and a molecular weight of 434.92 g/mol. Its IUPAC name is 14-(2-chlorophenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 14-(2-chlorophenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3744749 |
| Molecular Formula | C25H23ClN2O3 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 14-(2-chlorophenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CC(C)(C)C(=O)C1C2C(=O)N(c3ccccc3Cl)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C25H23ClN2O3/c1-25(2,3)22(29)21-19-18(20-15-9-5-4-8-14(15)12-13-27(20)21)23(30)28(24(19)31)17-11-7-6-10-16(17)26/h4-13,18-21H,1-3H3 |
| InChIKey | ZNGCUXZCZYPKEK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|