C27H28N2O5 — CID 93010622
(1S,11R,12S,16S)-14-(2,4-dimethoxyphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 93010622) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is (1S,11R,12S,16S)-14-(2,4-dimethoxyphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12S,16S)-14-(2,4-dimethoxyphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 93010622 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (1S,11R,12S,16S)-14-(2,4-dimethoxyphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](C2=O)[C@H](C(=O)C(C)(C)C)N2C=Cc4ccccc4[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C27H28N2O5/c1-27(2,3)24(30)23-21-20(22-17-9-7-6-8-15(17)12-13-28(22)23)25(31)29(26(21)32)18-11-10-16(33-4)14-19(18)34-5/h6-14,20-23H,1-5H3/t20-,21-,22+,23+/m0/s1 |
| InChIKey | ATOYITPMNRJLAL-MYDTUXCISA-N |
| XLogP | 3.83 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|