C26H25BrN2O3 — CID 98893991
(1S,11R,12R,16S)-14-(2-bromo-4-methylphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98893991) has the molecular formula C26H25BrN2O3 and a molecular weight of 493.40 g/mol. Its IUPAC name is (1S,11R,12R,16S)-14-(2-bromo-4-methylphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12R,16S)-14-(2-bromo-4-methylphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98893991 |
| Molecular Formula | C26H25BrN2O3 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (1S,11R,12R,16S)-14-(2-bromo-4-methylphenyl)-11-(2,2-dimethylpropanoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2c4ccccc4C=CN2[C@H]3C(=O)C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C26H25BrN2O3/c1-14-9-10-18(17(27)13-14)29-24(31)19-20(25(29)32)22(23(30)26(2,3)4)28-12-11-15-7-5-6-8-16(15)21(19)28/h5-13,19-22H,1-4H3/t19-,20+,21+,22+/m0/s1 |
| InChIKey | KYEUWQRVZZOKSC-DXBBTUNJSA-N |
| XLogP | 4.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|