C27H28N2O5S — CID 41089228
methyl 2-[(1S,11S,12R,16S)-11-(2,2-dimethylpropanoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 41089228) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is methyl 2-[(1S,11S,12R,16S)-11-(2,2-dimethylpropanoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(1S,11S,12R,16S)-11-(2,2-dimethylpropanoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 41089228 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | methyl 2-[(1S,11S,12R,16S)-11-(2,2-dimethylpropanoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2c4ccccc4C=CN2[C@@H]3C(=O)C(C)(C)C)sc(C)c1C |
| InChI | InChI=1S/C27H28N2O5S/c1-13-14(2)35-25(17(13)26(33)34-6)29-23(31)18-19(24(29)32)21(22(30)27(3,4)5)28-12-11-15-9-7-8-10-16(15)20(18)28/h7-12,18-21H,1-6H3/t18-,19+,20+,21-/m0/s1 |
| InChIKey | ICVOBUZHHHQLHR-BQJUDKOJSA-N |
| XLogP | 4.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|