C29H24N2O5S — CID 3918856
methyl 2-(11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)-4,5-dimethylthiophene-3-carboxylate (PubChem CID 3918856) has the molecular formula C29H24N2O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is methyl 2-(11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-(11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3918856 |
| Molecular Formula | C29H24N2O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | methyl 2-(11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)C3C(C2=O)C2c4ccccc4C=CN2C3C(=O)c2ccccc2)sc(C)c1C |
| InChI | InChI=1S/C29H24N2O5S/c1-15-16(2)37-28(20(15)29(35)36-3)31-26(33)21-22(27(31)34)24(25(32)18-10-5-4-6-11-18)30-14-13-17-9-7-8-12-19(17)23(21)30/h4-14,21-24H,1-3H3 |
| InChIKey | FHMCZZDWRAVDQE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|