C28H21ClN2O3 — CID 98450923
(1R,11S,12R,16R)-11-(4-chlorobenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98450923) has the molecular formula C28H21ClN2O3 and a molecular weight of 468.94 g/mol. Its IUPAC name is (1R,11S,12R,16R)-11-(4-chlorobenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16R)-11-(4-chlorobenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98450923 |
| Molecular Formula | C28H21ClN2O3 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (1R,11S,12R,16R)-11-(4-chlorobenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2c4ccccc4C=CN2[C@@H]3C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H21ClN2O3/c1-16-6-12-20(13-7-16)31-27(33)22-23(28(31)34)25(26(32)18-8-10-19(29)11-9-18)30-15-14-17-4-2-3-5-21(17)24(22)30/h2-15,22-25H,1H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | ARQAOKHKESWEHY-NGSHPTGOSA-N |
| XLogP | 5.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|