C30H26N2O5 — CID 98195472
(1R,11S,12R,16R)-11-(3,4-dimethoxybenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98195472) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is (1R,11S,12R,16R)-11-(3,4-dimethoxybenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16R)-11-(3,4-dimethoxybenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98195472 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (1R,11S,12R,16R)-11-(3,4-dimethoxybenzoyl)-14-(4-methylphenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@H]3[C@@H]3c4ccccc4C=CN23)cc1OC |
| InChI | InChI=1S/C30H26N2O5/c1-17-8-11-20(12-9-17)32-29(34)24-25(30(32)35)27(28(33)19-10-13-22(36-2)23(16-19)37-3)31-15-14-18-6-4-5-7-21(18)26(24)31/h4-16,24-27H,1-3H3/t24-,25-,26+,27+/m1/s1 |
| InChIKey | OVMJXVKKJLYODX-XDZXDJIYSA-N |
| XLogP | 4.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|