C30H24N2O7 — CID 3324810
14-(1,3-benzodioxol-5-yl)-11-(3,4-dimethoxybenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3324810) has the molecular formula C30H24N2O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is 14-(1,3-benzodioxol-5-yl)-11-(3,4-dimethoxybenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 14-(1,3-benzodioxol-5-yl)-11-(3,4-dimethoxybenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3324810 |
| Molecular Formula | C30H24N2O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 14-(1,3-benzodioxol-5-yl)-11-(3,4-dimethoxybenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(C(=O)C2C3C(=O)N(c4ccc5c(c4)OCO5)C(=O)C3C3c4ccccc4C=CN23)cc1OC |
| InChI | InChI=1S/C30H24N2O7/c1-36-20-9-7-17(13-22(20)37-2)28(33)27-25-24(26-19-6-4-3-5-16(19)11-12-31(26)27)29(34)32(30(25)35)18-8-10-21-23(14-18)39-15-38-21/h3-14,24-27H,15H2,1-2H3 |
| InChIKey | PLLFGMUIEJUCAR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|