C28H19N3O7 — CID 3559244
14-(1,3-benzodioxol-5-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3559244) has the molecular formula C28H19N3O7 and a molecular weight of 509.47 g/mol. Its IUPAC name is 14-(1,3-benzodioxol-5-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 14-(1,3-benzodioxol-5-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3559244 |
| Molecular Formula | C28H19N3O7 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 14-(1,3-benzodioxol-5-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)C1C2C(=O)N(c3ccc4c(c3)OCO4)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C28H19N3O7/c32-26(16-5-7-17(8-6-16)31(35)36)25-23-22(24-19-4-2-1-3-15(19)11-12-29(24)25)27(33)30(28(23)34)18-9-10-20-21(13-18)38-14-37-20/h1-13,22-25H,14H2 |
| InChIKey | GYQKRLLXCBXWLS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|