C30H22N2O7 — CID 125289933
(1S,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 125289933) has the molecular formula C30H22N2O7 and a molecular weight of 522.51 g/mol. Its IUPAC name is (1S,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 125289933 |
| Molecular Formula | C30H22N2O7 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (1S,11S,12R,16R)-11-(1,3-benzodioxole-5-carbonyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc2c(c1)OCO2)[C@@H]1[C@@H]2C(=O)N(c3ccc4c(c3)OCCO4)C(=O)[C@H]2[C@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C30H22N2O7/c33-28(17-5-7-21-22(13-17)39-15-38-21)27-25-24(26-19-4-2-1-3-16(19)9-10-31(26)27)29(34)32(30(25)35)18-6-8-20-23(14-18)37-12-11-36-20/h1-10,13-14,24-27H,11-12,15H2/t24-,25-,26-,27+/m1/s1 |
| InChIKey | KLMGHKMBQIGELN-CWTOASCOSA-N |
| XLogP | 3.58 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|