C30H22N2O7 — CID 2028983
[4-[(1S,11S,12R,16S)-14-(1,3-benzodioxol-5-yl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate (PubChem CID 2028983) has the molecular formula C30H22N2O7 and a molecular weight of 522.51 g/mol. Its IUPAC name is [4-[(1S,11S,12R,16S)-14-(1,3-benzodioxol-5-yl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate.
| Compound Name | [4-[(1S,11S,12R,16S)-14-(1,3-benzodioxol-5-yl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 2028983 |
| Molecular Formula | C30H22N2O7 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | [4-[(1S,11S,12R,16S)-14-(1,3-benzodioxol-5-yl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc5c(c4)OCO5)C(=O)[C@@H]3[C@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C30H22N2O7/c1-16(33)39-20-9-6-18(7-10-20)28(34)27-25-24(26-21-5-3-2-4-17(21)12-13-31(26)27)29(35)32(30(25)36)19-8-11-22-23(14-19)38-15-37-22/h2-14,24-27H,15H2,1H3/t24-,25+,26+,27-/m0/s1 |
| InChIKey | LMIRZYCFBUFMOF-YAOOYPAMSA-N |
| XLogP | 3.74 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|