C29H21BrN2O5 — CID 4920945
11-(4-bromobenzoyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 4920945) has the molecular formula C29H21BrN2O5 and a molecular weight of 557.40 g/mol. Its IUPAC name is 11-(4-bromobenzoyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 11-(4-bromobenzoyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 4920945 |
| Molecular Formula | C29H21BrN2O5 |
| Molecular Weight | 557.40 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 11-(4-bromobenzoyl)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(Br)cc1)C1C2C(=O)N(c3ccc4c(c3)OCCO4)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C29H21BrN2O5/c30-18-7-5-17(6-8-18)27(33)26-24-23(25-20-4-2-1-3-16(20)11-12-31(25)26)28(34)32(29(24)35)19-9-10-21-22(15-19)37-14-13-36-21/h1-12,15,23-26H,13-14H2 |
| InChIKey | UMVXMLNBWBDDBL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|