C29H21N3O7 — CID 124779709
(1S,11S,12R,16R)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 124779709) has the molecular formula C29H21N3O7 and a molecular weight of 523.50 g/mol. Its IUPAC name is (1S,11S,12R,16R)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16R)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 124779709 |
| Molecular Formula | C29H21N3O7 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | (1S,11S,12R,16R)-14-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-(4-nitrobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)[C@@H]1[C@@H]2C(=O)N(c3ccc4c(c3)OCCO4)C(=O)[C@H]2[C@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C29H21N3O7/c33-27(17-5-7-18(8-6-17)32(36)37)26-24-23(25-20-4-2-1-3-16(20)11-12-30(25)26)28(34)31(29(24)35)19-9-10-21-22(15-19)39-14-13-38-21/h1-12,15,23-26H,13-14H2/t23-,24-,25-,26+/m1/s1 |
| InChIKey | QORYLBNGQRYMJI-POTDNYQPSA-N |
| XLogP | 3.76 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|