C29H21N3O8 — CID 6358156
(1S,11S,12R,16S)-11-(1,3-benzodioxole-5-carbonyl)-14-(2-methoxy-5-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 6358156) has the molecular formula C29H21N3O8 and a molecular weight of 539.50 g/mol. Its IUPAC name is (1S,11S,12R,16S)-11-(1,3-benzodioxole-5-carbonyl)-14-(2-methoxy-5-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-11-(1,3-benzodioxole-5-carbonyl)-14-(2-methoxy-5-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 6358156 |
| Molecular Formula | C29H21N3O8 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | (1S,11S,12R,16S)-11-(1,3-benzodioxole-5-carbonyl)-14-(2-methoxy-5-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1c3ccccc3C=CN1[C@@H]2C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H21N3O8/c1-38-20-9-7-17(32(36)37)13-19(20)31-28(34)23-24(29(31)35)26(27(33)16-6-8-21-22(12-16)40-14-39-21)30-11-10-15-4-2-3-5-18(15)25(23)30/h2-13,23-26H,14H2,1H3/t23-,24+,25+,26-/m0/s1 |
| InChIKey | VDCXPRKVHGNAEK-QUMGSSFMSA-N |
| XLogP | 3.73 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|