C30H24N2O5 — CID 6588000
ethyl 4-[(1S,11S,12R,16R)-11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate (PubChem CID 6588000) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is ethyl 4-[(1S,11S,12R,16R)-11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate.
| Compound Name | ethyl 4-[(1S,11S,12R,16R)-11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate |
|---|---|
| PubChem CID | 6588000 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl 4-[(1S,11S,12R,16R)-11-benzoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2c4ccccc4C=CN2[C@@H]3C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2O5/c1-2-37-30(36)20-12-14-21(15-13-20)32-28(34)23-24(29(32)35)26(27(33)19-9-4-3-5-10-19)31-17-16-18-8-6-7-11-22(18)25(23)31/h3-17,23-26H,2H2,1H3/t23-,24-,25-,26+/m1/s1 |
| InChIKey | ZJOISBMKYHNDBR-POTDNYQPSA-N |
| XLogP | 4.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|