C27H18BrClN2O3 — CID 98452595
(1R,11R,12S,16S)-14-(3-bromophenyl)-11-(4-chlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98452595) has the molecular formula C27H18BrClN2O3 and a molecular weight of 533.81 g/mol. Its IUPAC name is (1R,11R,12S,16S)-14-(3-bromophenyl)-11-(4-chlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11R,12S,16S)-14-(3-bromophenyl)-11-(4-chlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98452595 |
| Molecular Formula | C27H18BrClN2O3 |
| Molecular Weight | 533.81 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | (1R,11R,12S,16S)-14-(3-bromophenyl)-11-(4-chlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H]1[C@H]2C(=O)N(c3cccc(Br)c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H18BrClN2O3/c28-17-5-3-6-19(14-17)31-26(33)21-22(27(31)34)24(25(32)16-8-10-18(29)11-9-16)30-13-12-15-4-1-2-7-20(15)23(21)30/h1-14,21-24H/t21-,22-,23-,24+/m0/s1 |
| InChIKey | VCVFEXZMBGMCDS-NEWJYFPISA-N |
| XLogP | 5.50 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.81 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|