C27H19ClN2O3 — CID 100824472
(1R,11S,12R,16S)-11-benzoyl-14-(2-chlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 100824472) has the molecular formula C27H19ClN2O3 and a molecular weight of 454.91 g/mol. Its IUPAC name is (1R,11S,12R,16S)-11-benzoyl-14-(2-chlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16S)-11-benzoyl-14-(2-chlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 100824472 |
| Molecular Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (1R,11S,12R,16S)-11-benzoyl-14-(2-chlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H]2C(=O)N(c3ccccc3Cl)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H19ClN2O3/c28-19-12-6-7-13-20(19)30-26(32)21-22(27(30)33)24(25(31)17-9-2-1-3-10-17)29-15-14-16-8-4-5-11-18(16)23(21)29/h1-15,21-24H/t21-,22+,23-,24-/m0/s1 |
| InChIKey | MWHNCJZHYQZQHH-KIHHCIJBSA-N |
| XLogP | 4.74 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|