C27H22N2O5S2 — CID 40906755
methyl 2-[(1R,11S,12R,16R)-13,15-dioxo-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 40906755) has the molecular formula C27H22N2O5S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is methyl 2-[(1R,11S,12R,16R)-13,15-dioxo-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(1R,11S,12R,16R)-13,15-dioxo-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 40906755 |
| Molecular Formula | C27H22N2O5S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | methyl 2-[(1R,11S,12R,16R)-13,15-dioxo-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2c4ccccc4C=CN2[C@@H]3C(=O)c2cccs2)sc(C)c1C |
| InChI | InChI=1S/C27H22N2O5S2/c1-13-14(2)36-26(18(13)27(33)34-3)29-24(31)19-20(25(29)32)22(23(30)17-9-6-12-35-17)28-11-10-15-7-4-5-8-16(15)21(19)28/h4-12,19-22H,1-3H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | XRJPOPAWGLBWLU-CZYKHXBRSA-N |
| XLogP | 4.61 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|