C24H20N2O5 — CID 3831788
methyl 2-(11-acetyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)benzoate (PubChem CID 3831788) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is methyl 2-(11-acetyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)benzoate.
| Compound Name | methyl 2-(11-acetyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)benzoate |
|---|---|
| PubChem CID | 3831788 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | methyl 2-(11-acetyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl)benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)C2C(C1=O)C1c3ccccc3C=CN1C2C(C)=O |
| InChI | InChI=1S/C24H20N2O5/c1-13(27)20-18-19(21-15-8-4-3-7-14(15)11-12-25(20)21)23(29)26(22(18)28)17-10-6-5-9-16(17)24(30)31-2/h3-12,18-21H,1-2H3 |
| InChIKey | TYYBNAHWBODADQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|