C23H19N3O5 — CID 98300177
methyl 2-[(1S,11S,12R,16R)-11-carbamoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate (PubChem CID 98300177) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is methyl 2-[(1S,11S,12R,16R)-11-carbamoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate.
| Compound Name | methyl 2-[(1S,11S,12R,16R)-11-carbamoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate |
|---|---|
| PubChem CID | 98300177 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | methyl 2-[(1S,11S,12R,16R)-11-carbamoyl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1c3ccccc3C=CN1[C@@H]2C(N)=O |
| InChI | InChI=1S/C23H19N3O5/c1-31-23(30)14-8-4-5-9-15(14)26-21(28)16-17(22(26)29)19(20(24)27)25-11-10-12-6-2-3-7-13(12)18(16)25/h2-11,16-19H,1H3,(H2,24,27)/t16-,17-,18-,19+/m1/s1 |
| InChIKey | CMRUCAPWVGLMEN-MKXGPGLRSA-N |
| XLogP | 1.47 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|