C26H19ClN2O3S — CID 124773542
(1S,11R,12R,16S)-14-(5-chloro-2-methylphenyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 124773542) has the molecular formula C26H19ClN2O3S and a molecular weight of 474.97 g/mol. Its IUPAC name is (1S,11R,12R,16S)-14-(5-chloro-2-methylphenyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12R,16S)-14-(5-chloro-2-methylphenyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 124773542 |
| Molecular Formula | C26H19ClN2O3S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (1S,11R,12R,16S)-14-(5-chloro-2-methylphenyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | Cc1ccc(Cl)cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1c3ccccc3C=CN1[C@H]2C(=O)c1cccs1 |
| InChI | InChI=1S/C26H19ClN2O3S/c1-14-8-9-16(27)13-18(14)29-25(31)20-21(26(29)32)23(24(30)19-7-4-12-33-19)28-11-10-15-5-2-3-6-17(15)22(20)28/h2-13,20-23H,1H3/t20-,21+,22+,23+/m0/s1 |
| InChIKey | IFFGIPWNYOMBLL-WBADGQHESA-N |
| XLogP | 5.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|