C27H22N2O6 — CID 6357678
(1S,11S,12R,16S)-14-(2,5-dimethoxyphenyl)-11-(furan-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 6357678) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is (1S,11S,12R,16S)-14-(2,5-dimethoxyphenyl)-11-(furan-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-14-(2,5-dimethoxyphenyl)-11-(furan-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 6357678 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (1S,11S,12R,16S)-14-(2,5-dimethoxyphenyl)-11-(furan-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2c4ccccc4C=CN2[C@@H]3C(=O)c2ccco2)c1 |
| InChI | InChI=1S/C27H22N2O6/c1-33-16-9-10-19(34-2)18(14-16)29-26(31)21-22(27(29)32)24(25(30)20-8-5-13-35-20)28-12-11-15-6-3-4-7-17(15)23(21)28/h3-14,21-24H,1-2H3/t21-,22+,23+,24-/m0/s1 |
| InChIKey | CSJAVUDXEOWLEA-KEZOAJOQSA-N |
| XLogP | 3.70 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|