C27H20ClN3O3 — CID 3767093
14-(3-chlorophenyl)-13,15-dioxo-N-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 3767093) has the molecular formula C27H20ClN3O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is 14-(3-chlorophenyl)-13,15-dioxo-N-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | 14-(3-chlorophenyl)-13,15-dioxo-N-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 3767093 |
| Molecular Formula | C27H20ClN3O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 14-(3-chlorophenyl)-13,15-dioxo-N-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C2C(=O)N(c3cccc(Cl)c3)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H20ClN3O3/c28-17-8-6-11-19(15-17)31-26(33)21-22(27(31)34)24(25(32)29-18-9-2-1-3-10-18)30-14-13-16-7-4-5-12-20(16)23(21)30/h1-15,21-24H,(H,29,32) |
| InChIKey | WUFMLVSCWUWIQP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|