C35H28N2O5 — CID 98325773
benzhydryl (1R,11S,12R,16R)-14-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate (PubChem CID 98325773) has the molecular formula C35H28N2O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is benzhydryl (1R,11S,12R,16R)-14-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate.
| Compound Name | benzhydryl (1R,11S,12R,16R)-14-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 98325773 |
| Molecular Formula | C35H28N2O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | benzhydryl (1R,11S,12R,16R)-14-(4-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2c4ccccc4C=CN2[C@@H]3C(=O)OC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H28N2O5/c1-41-26-18-16-25(17-19-26)37-33(38)28-29(34(37)39)31(36-21-20-22-10-8-9-15-27(22)30(28)36)35(40)42-32(23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-21,28-32H,1H3/t28-,29-,30+,31+/m1/s1 |
| InChIKey | PKHULJNYASEEFZ-VKONIRKNSA-N |
| XLogP | 5.54 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|