C38H28N2O4 — CID 98508678
benzhydryl (1S,11R,12S,16S)-14-naphthalen-1-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate (PubChem CID 98508678) has the molecular formula C38H28N2O4 and a molecular weight of 576.65 g/mol. Its IUPAC name is benzhydryl (1S,11R,12S,16S)-14-naphthalen-1-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate.
| Compound Name | benzhydryl (1S,11R,12S,16S)-14-naphthalen-1-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 98508678 |
| Molecular Formula | C38H28N2O4 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | benzhydryl (1S,11R,12S,16S)-14-naphthalen-1-yl-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)[C@H]1[C@H]2C(=O)N(c3cccc4ccccc34)C(=O)[C@@H]2[C@H]2c3ccccc3C=CN21 |
| InChI | InChI=1S/C38H28N2O4/c41-36-31-32(37(42)40(36)30-21-11-18-24-12-7-9-19-28(24)30)34(39-23-22-25-13-8-10-20-29(25)33(31)39)38(43)44-35(26-14-3-1-4-15-26)27-16-5-2-6-17-27/h1-23,31-35H/t31-,32-,33+,34+/m0/s1 |
| InChIKey | SVSCQAOVTQLVFU-PSWJWLENSA-N |
| XLogP | 6.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|