C29H21F3N4O6 — CID 44660529
(11S,12R,16S)-14-(2-methoxy-5-nitrophenyl)-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 44660529) has the molecular formula C29H21F3N4O6 and a molecular weight of 578.50 g/mol. Its IUPAC name is (11S,12R,16S)-14-(2-methoxy-5-nitrophenyl)-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (11S,12R,16S)-14-(2-methoxy-5-nitrophenyl)-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 44660529 |
| Molecular Formula | C29H21F3N4O6 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (11S,12R,16S)-14-(2-methoxy-5-nitrophenyl)-13,15-dioxo-N-[3-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H](C1=O)C1c3ccccc3C=CN1[C@@H]2C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H21F3N4O6/c1-42-21-10-9-18(36(40)41)14-20(21)35-27(38)22-23(28(35)39)25(34-12-11-15-5-2-3-8-19(15)24(22)34)26(37)33-17-7-4-6-16(13-17)29(30,31)32/h2-14,22-25H,1H3,(H,33,37)/t22-,23+,24?,25-/m0/s1 |
| InChIKey | ZNOMBJXCCMRLER-NPZNXQLHSA-N |
| XLogP | 4.78 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|