C28H21ClN4O6 — CID 3356895
N-(4-chloro-3-nitrophenyl)-14-(2-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 3356895) has the molecular formula C28H21ClN4O6 and a molecular weight of 544.95 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-14-(2-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-14-(2-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 3356895 |
| Molecular Formula | C28H21ClN4O6 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-14-(2-methoxyphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | COc1ccccc1N1C(=O)C2C(C1=O)C1c3ccccc3C=CN1C2C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H21ClN4O6/c1-39-21-9-5-4-8-19(21)32-27(35)22-23(28(32)36)25(31-13-12-15-6-2-3-7-17(15)24(22)31)26(34)30-16-10-11-18(29)20(14-16)33(37)38/h2-14,22-25H,1H3,(H,30,34) |
| InChIKey | RNFZWLJSTLRXID-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|