C29H23ClN4O5 — CID 6358472
(1S,11S,12R,16S)-N-(4-chloro-3-nitrophenyl)-14-(3,5-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 6358472) has the molecular formula C29H23ClN4O5 and a molecular weight of 542.98 g/mol. Its IUPAC name is (1S,11S,12R,16S)-N-(4-chloro-3-nitrophenyl)-14-(3,5-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1S,11S,12R,16S)-N-(4-chloro-3-nitrophenyl)-14-(3,5-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 6358472 |
| Molecular Formula | C29H23ClN4O5 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | (1S,11S,12R,16S)-N-(4-chloro-3-nitrophenyl)-14-(3,5-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | Cc1cc(C)cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2c4ccccc4C=CN2[C@@H]3C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H23ClN4O5/c1-15-11-16(2)13-19(12-15)33-28(36)23-24(29(33)37)26(32-10-9-17-5-3-4-6-20(17)25(23)32)27(35)31-18-7-8-21(30)22(14-18)34(38)39/h3-14,23-26H,1-2H3,(H,31,35)/t23-,24+,25+,26-/m0/s1 |
| InChIKey | QJTICNCAZQDWIA-QUMGSSFMSA-N |
| XLogP | 5.02 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|