C22H15ClN4O5 — CID 3440029
7-benzoyl-4-(2-chloro-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 3440029) has the molecular formula C22H15ClN4O5 and a molecular weight of 450.84 g/mol. Its IUPAC name is 7-benzoyl-4-(2-chloro-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | 7-benzoyl-4-(2-chloro-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 3440029 |
| Molecular Formula | C22H15ClN4O5 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 7-benzoyl-4-(2-chloro-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | O=C(c1ccccc1)C1C2C(=O)N(c3cc([N+](=O)[O-])ccc3Cl)C(=O)C2C2C=CC=NN21 |
| InChI | InChI=1S/C22H15ClN4O5/c23-14-9-8-13(27(31)32)11-16(14)25-21(29)17-15-7-4-10-24-26(15)19(18(17)22(25)30)20(28)12-5-2-1-3-6-12/h1-11,15,17-19H |
| InChIKey | KKMKPPZWRNPUAM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|