C23H18N4O5 — CID 3796579
7-benzoyl-4-(2-methyl-4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 3796579) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is 7-benzoyl-4-(2-methyl-4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | 7-benzoyl-4-(2-methyl-4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 3796579 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 7-benzoyl-4-(2-methyl-4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)C2C(C1=O)C(C(=O)c1ccccc1)N1N=CC=CC21 |
| InChI | InChI=1S/C23H18N4O5/c1-13-12-15(27(31)32)9-10-16(13)25-22(29)18-17-8-5-11-24-26(17)20(19(18)23(25)30)21(28)14-6-3-2-4-7-14/h2-12,17-20H,1H3 |
| InChIKey | DIKMEPIJUPGTNE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|