C21H22N4O5 — CID 51428267
(1S,2S,6R,7S)-7-(2,2-dimethylpropanoyl)-4-(2-methyl-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 51428267) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is (1S,2S,6R,7S)-7-(2,2-dimethylpropanoyl)-4-(2-methyl-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | (1S,2S,6R,7S)-7-(2,2-dimethylpropanoyl)-4-(2-methyl-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 51428267 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (1S,2S,6R,7S)-7-(2,2-dimethylpropanoyl)-4-(2-methyl-5-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=CC=NN1[C@@H]2C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H22N4O5/c1-11-7-8-12(25(29)30)10-14(11)23-19(27)15-13-6-5-9-22-24(13)17(16(15)20(23)28)18(26)21(2,3)4/h5-10,13,15-17H,1-4H3/t13-,15+,16+,17-/m0/s1 |
| InChIKey | QDGKZHNFOUFZDW-SVGFKBNWSA-N |
| XLogP | 2.23 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|