C20H19Cl2N3O3 — CID 41020778
(1R,2S,6S,7R)-4-(3,5-dichlorophenyl)-7-(2,2-dimethylpropanoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 41020778) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-(3,5-dichlorophenyl)-7-(2,2-dimethylpropanoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-(3,5-dichlorophenyl)-7-(2,2-dimethylpropanoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 41020778 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | (1R,2S,6S,7R)-4-(3,5-dichlorophenyl)-7-(2,2-dimethylpropanoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | CC(C)(C)C(=O)[C@H]1[C@H]2C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)[C@@H]2[C@H]2C=CC=NN21 |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-20(2,3)17(26)16-15-14(13-5-4-6-23-25(13)16)18(27)24(19(15)28)12-8-10(21)7-11(22)9-12/h4-9,13-16H,1-3H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | PBCZZUVKQDBLBP-LVQVYYBASA-N |
| XLogP | 3.32 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|