C26H19ClN4O3 — CID 92509063
(1S,2S,6R,7S)-N-(4-chlorophenyl)-4-naphthalen-2-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide (PubChem CID 92509063) has the molecular formula C26H19ClN4O3 and a molecular weight of 470.92 g/mol. Its IUPAC name is (1S,2S,6R,7S)-N-(4-chlorophenyl)-4-naphthalen-2-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide.
| Compound Name | (1S,2S,6R,7S)-N-(4-chlorophenyl)-4-naphthalen-2-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide |
|---|---|
| PubChem CID | 92509063 |
| Molecular Formula | C26H19ClN4O3 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (1S,2S,6R,7S)-N-(4-chlorophenyl)-4-naphthalen-2-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H]1[C@@H]2C(=O)N(c3ccc4ccccc4c3)C(=O)[C@@H]2[C@@H]2C=CC=NN12 |
| InChI | InChI=1S/C26H19ClN4O3/c27-17-8-10-18(11-9-17)29-24(32)23-22-21(20-6-3-13-28-31(20)23)25(33)30(26(22)34)19-12-7-15-4-1-2-5-16(15)14-19/h1-14,20-23H,(H,29,32)/t20-,21+,22+,23-/m0/s1 |
| InChIKey | YJRYARLSNWFHFR-AFXVXQJMSA-N |
| XLogP | 3.85 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|