C22H17FN4O3 — CID 4689043
4-(4-fluorophenyl)-3,5-dioxo-N-phenyl-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide (PubChem CID 4689043) has the molecular formula C22H17FN4O3 and a molecular weight of 404.40 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,5-dioxo-N-phenyl-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-3,5-dioxo-N-phenyl-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide |
|---|---|
| PubChem CID | 4689043 |
| Molecular Formula | C22H17FN4O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-(4-fluorophenyl)-3,5-dioxo-N-phenyl-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C2C(=O)N(c3ccc(F)cc3)C(=O)C2C2C=CC=NN21 |
| InChI | InChI=1S/C22H17FN4O3/c23-13-8-10-15(11-9-13)26-21(29)17-16-7-4-12-24-27(16)19(18(17)22(26)30)20(28)25-14-5-2-1-3-6-14/h1-12,16-19H,(H,25,28) |
| InChIKey | VWBWVZNARLZMOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|