C22H15Cl3N4O3 — CID 124894873
(1R,2R,6R,7S)-N-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide (PubChem CID 124894873) has the molecular formula C22H15Cl3N4O3 and a molecular weight of 489.75 g/mol. Its IUPAC name is (1R,2R,6R,7S)-N-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide.
| Compound Name | (1R,2R,6R,7S)-N-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide |
|---|---|
| PubChem CID | 124894873 |
| Molecular Formula | C22H15Cl3N4O3 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | (1R,2R,6R,7S)-N-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H]1[C@@H]2C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@H]2[C@H]2C=CC=NN21 |
| InChI | InChI=1S/C22H15Cl3N4O3/c23-11-3-6-13(7-4-11)27-20(30)19-18-17(16-2-1-9-26-29(16)19)21(31)28(22(18)32)15-8-5-12(24)10-14(15)25/h1-10,16-19H,(H,27,30)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | VJHOKVMYCNDOMR-HCXYKTFWSA-N |
| XLogP | 4.00 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|