C24H19Cl2N3O5 — CID 3423554
4-(2,4-dichlorophenyl)-7-(3,4-dimethoxybenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 3423554) has the molecular formula C24H19Cl2N3O5 and a molecular weight of 500.34 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-7-(3,4-dimethoxybenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | 4-(2,4-dichlorophenyl)-7-(3,4-dimethoxybenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 3423554 |
| Molecular Formula | C24H19Cl2N3O5 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-7-(3,4-dimethoxybenzoyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | COc1ccc(C(=O)C2C3C(=O)N(c4ccc(Cl)cc4Cl)C(=O)C3C3C=CC=NN32)cc1OC |
| InChI | InChI=1S/C24H19Cl2N3O5/c1-33-17-8-5-12(10-18(17)34-2)22(30)21-20-19(16-4-3-9-27-29(16)21)23(31)28(24(20)32)15-7-6-13(25)11-14(15)26/h3-11,16,19-21H,1-2H3 |
| InChIKey | BZCVAUDEJYXXOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|