C24H20N4O7 — CID 3948072
7-(3,4-dimethoxybenzoyl)-4-(4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 3948072) has the molecular formula C24H20N4O7 and a molecular weight of 476.45 g/mol. Its IUPAC name is 7-(3,4-dimethoxybenzoyl)-4-(4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | 7-(3,4-dimethoxybenzoyl)-4-(4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 3948072 |
| Molecular Formula | C24H20N4O7 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 7-(3,4-dimethoxybenzoyl)-4-(4-nitrophenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | COc1ccc(C(=O)C2C3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C3C3C=CC=NN32)cc1OC |
| InChI | InChI=1S/C24H20N4O7/c1-34-17-10-5-13(12-18(17)35-2)22(29)21-20-19(16-4-3-11-25-27(16)21)23(30)26(24(20)31)14-6-8-15(9-7-14)28(32)33/h3-12,16,19-21H,1-2H3 |
| InChIKey | AHWPIDXIVWTZQJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 131.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|