C25H23N3O6 — CID 3796022
7-(3,4-dimethoxybenzoyl)-4-(2-methoxyphenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione (PubChem CID 3796022) has the molecular formula C25H23N3O6 and a molecular weight of 461.47 g/mol. Its IUPAC name is 7-(3,4-dimethoxybenzoyl)-4-(2-methoxyphenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione.
| Compound Name | 7-(3,4-dimethoxybenzoyl)-4-(2-methoxyphenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
|---|---|
| PubChem CID | 3796022 |
| Molecular Formula | C25H23N3O6 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 7-(3,4-dimethoxybenzoyl)-4-(2-methoxyphenyl)-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione |
| SMILES | COc1ccc(C(=O)C2C3C(=O)N(c4ccccc4OC)C(=O)C3C3C=CC=NN32)cc1OC |
| InChI | InChI=1S/C25H23N3O6/c1-32-17-9-5-4-7-15(17)27-24(30)20-16-8-6-12-26-28(16)22(21(20)25(27)31)23(29)14-10-11-18(33-2)19(13-14)34-3/h4-13,16,20-22H,1-3H3 |
| InChIKey | BGXWMQNBPQJOKP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|