C28H21N3O5 — CID 124894049
[4-[(1R,2R,6R,7S)-4-naphthalen-1-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate (PubChem CID 124894049) has the molecular formula C28H21N3O5 and a molecular weight of 479.49 g/mol. Its IUPAC name is [4-[(1R,2R,6R,7S)-4-naphthalen-1-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate.
| Compound Name | [4-[(1R,2R,6R,7S)-4-naphthalen-1-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 124894049 |
| Molecular Formula | C28H21N3O5 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [4-[(1R,2R,6R,7S)-4-naphthalen-1-yl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@H]3[C@H]3C=CC=NN32)cc1 |
| InChI | InChI=1S/C28H21N3O5/c1-16(32)36-19-13-11-18(12-14-19)26(33)25-24-23(22-10-5-15-29-31(22)25)27(34)30(28(24)35)21-9-4-7-17-6-2-3-8-20(17)21/h2-15,22-25H,1H3/t22-,23+,24-,25+/m1/s1 |
| InChIKey | BABKAYNXVYZGGU-RCTAOEEJSA-N |
| XLogP | 3.36 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|