C24H17Cl2N3O5 — CID 3821589
[4-[4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate (PubChem CID 3821589) has the molecular formula C24H17Cl2N3O5 and a molecular weight of 498.32 g/mol. Its IUPAC name is [4-[4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate.
| Compound Name | [4-[4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 3821589 |
| Molecular Formula | C24H17Cl2N3O5 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | [4-[4-(2,4-dichlorophenyl)-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-diene-7-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)C2C3C(=O)N(c4ccc(Cl)cc4Cl)C(=O)C3C3C=CC=NN32)cc1 |
| InChI | InChI=1S/C24H17Cl2N3O5/c1-12(30)34-15-7-4-13(5-8-15)22(31)21-20-19(18-3-2-10-27-29(18)21)23(32)28(24(20)33)17-9-6-14(25)11-16(17)26/h2-11,18-21H,1H3 |
| InChIKey | GQGNBPNPISRPSX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|