C24H19N3O5 — CID 27829318
[4-[(1R,2R,6S,7R)-7-benzoyl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-dien-4-yl]phenyl] acetate (PubChem CID 27829318) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is [4-[(1R,2R,6S,7R)-7-benzoyl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-dien-4-yl]phenyl] acetate.
| Compound Name | [4-[(1R,2R,6S,7R)-7-benzoyl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-dien-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 27829318 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [4-[(1R,2R,6S,7R)-7-benzoyl-3,5-dioxo-4,8,9-triazatricyclo[6.4.0.02,6]dodeca-9,11-dien-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H](C(=O)c2ccccc2)N2N=CC=C[C@H]32)cc1 |
| InChI | InChI=1S/C24H19N3O5/c1-14(28)32-17-11-9-16(10-12-17)26-23(30)19-18-8-5-13-25-27(18)21(20(19)24(26)31)22(29)15-6-3-2-4-7-15/h2-13,18-21H,1H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | UTYXMQOBMVGVFW-IVAOSVALSA-N |
| XLogP | 2.21 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|